CAS 87733-66-2
:Ginsenoside Rs2
Description:
Ginsenoside Rs2 is a triterpenoid saponin primarily derived from ginseng, a plant known for its medicinal properties. It is one of the many ginsenosides, which are the active compounds believed to contribute to ginseng's health benefits. Ginsenoside Rs2 is characterized by its complex molecular structure, which includes a steroid-like backbone with various sugar moieties attached, influencing its solubility and biological activity. This compound exhibits a range of pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties. Research suggests that ginsenoside Rs2 may enhance cognitive function and support cardiovascular health. Its mechanism of action often involves modulation of various signaling pathways and interaction with specific receptors in the body. As with many natural products, the bioavailability and efficacy of ginsenoside Rs2 can be influenced by factors such as formulation and individual metabolism. Overall, ginsenoside Rs2 represents a significant area of interest in phytochemistry and pharmacology, particularly in the context of traditional medicine and modern therapeutic applications.
Formula:C55H92O23
InChI:InChI=1S/C55H92O23/c1-24(2)11-10-15-55(9,78-49-45(69)41(65)39(63)31(75-49)23-71-47-43(67)37(61)29(21-57)72-47)26-12-17-54(8)35(26)27(59)19-33-52(6)16-14-34(51(4,5)32(52)13-18-53(33,54)7)76-50-46(42(66)36(60)28(20-56)73-50)77-48-44(68)40(64)38(62)30(74-48)22-70-25(3)58/h11,26-50,56-57,59-69H,10,12-23H2,1-9H3/t26-,27+,28+,29-,30+,31+,32-,33+,34-,35-,36+,37-,38+,39+,40-,41-,42-,43+,44+,45+,46+,47+,48-,49-,50-,52-,53+,54+,55-/m0/s1
InChI key:InChIKey=XUBSZCIZVSPSMQ-HTVDCONZSA-N
SMILES:C[C@]12[C@@]3(C)[C@@]([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](O[C@H]5[C@H](O[C@@H]6O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]6O)[C@@H](O)[C@H](O)[C@@H](CO)O5)CC4)[H])(C[C@@H](O)[C@@]1([C@@]([C@@](O[C@@H]7O[C@H](CO[C@@H]8O[C@@H](CO)[C@H](O)[C@H]8O)[C@@H](O)[C@H](O)[C@H]7O)(CCC=C(C)C)C)(CC2)[H])[H])[H]
Synonyms:- Ginsenoside Rs2
- β-D-Glucopyranoside, (3β,12β)-20-[(6-O-α-L-arabinofuranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-(6-O-acetyl-β-D-glucopyranosyl)-
- (3β,12β)-20-[(6-O-α-L-Arabinofuranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-(6-O-acetyl-β-D-glucopyranosyl)-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ginsenoside Rs2
CAS:Ginsenoside Rs2 is a natural product isolated from the leaves of Panax japonicus var..Formula:C55H92O23Purity:94% - 98.54%Color and Shape:SolidMolecular weight:1121.31Ginsenoside RS2
CAS:Ginsenoside RS2 is a saponin compound, which is derived from the roots of the Panax ginseng plant, known for its diverse pharmacological properties. This bioactive compound functions by modulating various cellular signaling pathways, including those involved in inflammation, apoptosis, and oxidative stress response. Ginsenoside RS2 interacts with key molecular targets, such as kinases and transcription factors, to exert its biological effects.
Formula:C55H92O23Purity:Min. 95%Molecular weight:1,121.3 g/mol


