CAS 87734-68-7
:Typhasterol
Description:
Typhasterol is a naturally occurring sterol, specifically a type of phytosterol, which is primarily found in various plant species. It is characterized by its structural similarity to cholesterol, featuring a steroid nucleus with multiple fused rings and a hydroxyl group. Typhasterol is known for its role in plant physiology, contributing to membrane fluidity and stability. It has garnered interest in the field of pharmacology due to its potential health benefits, including anti-inflammatory and antioxidant properties. Additionally, typhasterol may exhibit effects on cholesterol metabolism and has been studied for its potential applications in treating certain health conditions. Its CAS number, 87734-68-7, is a unique identifier that facilitates the cataloging and referencing of this compound in scientific literature and databases. Overall, typhasterol represents a significant compound in both plant biology and medicinal chemistry, highlighting the importance of phytosterols in health and disease.
Formula:C28H48O4
InChI:InChI=1S/C28H48O4/c1-15(2)16(3)25(31)26(32)17(4)20-7-8-21-19-14-24(30)23-13-18(29)9-11-28(23,6)22(19)10-12-27(20,21)5/h15-23,25-26,29,31-32H,7-14H2,1-6H3/t16-,17-,18+,19-,20+,21-,22-,23+,25+,26+,27+,28+/m0/s1
InChI key:InChIKey=SBSXXCCMIWEPEE-SELDZKRUSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](C(=O)C3)(C[C@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H]([C@H]([C@@H]([C@H](C(C)C)C)O)O)C)[H])[H]
Synonyms:- (3α,5α,22R,23R,24S)-3,22,23-Trihydroxyergostan-6-one
- Ergostan-6-one, 3,22,23-trihydroxy-, (3α,5α,22R,23R,24S)-
- Typhasterol
- 2-Deoxycastasterone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Typhasterol
CAS:Controlled ProductApplications Typhasterol can be used in biological study for role of plant steroid hormones produced under Ni stress in regulation of metal uptake and oxidative stress in Brassica juncea L.
References Kanwar, M. K., et al.: Chemosphere, 86, 41-49 (2012)Formula:C28H48O4Color and Shape:NeatMolecular weight:448.678Typhasterol
CAS:Typhasterol is a plant growth regulator, which is a naturally occurring brassinosteroid. It is sourced from plant tissues where it plays a crucial role in the regulation of growth and development. The mode of action of Typhasterol involves the modulation of plant signaling pathways, which enhances cell elongation, division, and differentiation. This activity is critical for a range of developmental processes, including seed germination, flowering, and fruit development.Formula:C28H48O4Purity:Min. 95%Molecular weight:448.70 g/mol

