CymitQuimica logo

CAS 87734-77-8

:

5-oxo-L-prolyl-L-leucyl-L-tryptophyl-L-alanyl-L-valylglycyl-L-seryl-L-phenylalanyl-L-methioninamide

Description:
5-oxo-L-prolyl-L-leucyl-L-tryptophyl-L-alanyl-L-valylglycyl-L-seryl-L-phenylalanyl-L-methioninamide, with the CAS number 87734-77-8, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It is composed of a sequence of amino acids, which contributes to its structural and functional properties. The presence of the 5-oxo group indicates a modification that may influence its biological activity, stability, and interaction with biological targets. Peptides like this one often play roles in various biological processes, including signaling, enzyme activity, and cellular communication. The specific sequence of amino acids suggests potential for specific receptor binding or enzymatic activity, which can be explored in pharmacological or biochemical studies. Additionally, the amide group at the end of the molecule may enhance its stability against enzymatic degradation. Overall, this compound's characteristics make it a subject of interest in research related to peptide chemistry and potential therapeutic applications.
Formula:C49H69N11O11S
InChI:InChI=1/C49H69N11O11S/c1-26(2)20-35(57-44(66)34-16-17-39(62)54-34)46(68)59-37(22-30-23-51-32-15-11-10-14-31(30)32)45(67)53-28(5)43(65)60-41(27(3)4)49(71)52-24-40(63)55-38(25-61)48(70)58-36(21-29-12-8-7-9-13-29)47(69)56-33(42(50)64)18-19-72-6/h7-15,23,26-28,33-38,41,51,61H,16-22,24-25H2,1-6H3,(H2,50,64)(H,52,71)(H,53,67)(H,54,62)(H,55,63)(H,56,69)(H,57,66)(H,58,70)(H,59,68)(H,60,65)/t28-,33-,34-,35-,36-,37-,38-,41-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=N[C@@H](C)C(=N[C@@H](C(C)C)C(=NCC(=N[C@@H](CO)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CCSC)C(=N)O)O)O)O)O)O)O)O)N=C([C@@H]1CCC(=N1)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.