
CAS 87736-69-4
:3-Phenyl-5-(2-thienylmethylene)-2-thioxo-4-imidazolidinone
Description:
3-Phenyl-5-(2-thienylmethylene)-2-thioxo-4-imidazolidinone is a heterocyclic compound characterized by its imidazolidinone core, which features a thioxo group and a phenyl and thienylmethylene substituent. This compound typically exhibits a range of interesting chemical properties due to the presence of sulfur and nitrogen atoms in its structure, which can influence its reactivity and stability. The thioxo group contributes to its potential as a nucleophile, while the imidazolidinone framework can participate in various chemical reactions, including cyclization and condensation. Additionally, the presence of aromatic rings (phenyl and thienyl) can enhance its electronic properties, making it suitable for applications in organic synthesis and potentially in pharmaceuticals. The compound may also exhibit biological activity, although specific biological properties would require further investigation. Overall, its unique structure and functional groups make it a compound of interest in both synthetic and medicinal chemistry.
Formula:C14H10N2OS2
InChI:InChI=1S/C14H10N2OS2/c17-13-12(9-11-7-4-8-19-11)15-14(18)16(13)10-5-2-1-3-6-10/h1-9H,(H,15,18)
InChI key:InChIKey=VOBGCINEIKSOFY-UHFFFAOYSA-N
SMILES:O=C1N(C(=S)NC1=CC2=CC=CS2)C3=CC=CC=C3
Synonyms:- 4-Imidazolidinone, 3-phenyl-5-(2-thienylmethylene)-2-thioxo-
- 3-Phenyl-5-(2-thienylmethylene)-2-thioxo-4-imidazolidinone
- 3-Phenyl-5-thiophen-2-ylmethylene-2-thioxo-imidazolidin-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.