CAS 87736-79-6
:(1Z)-2,2,2-trifluoro-1-(4-methylphenyl)-N-{[(4-methylphenyl)sulfonyl]oxy}ethanimine
Description:
(1Z)-2,2,2-Trifluoro-1-(4-methylphenyl)-N-{[(4-methylphenyl)sulfonyl]oxy}ethanimine, with the CAS number 87736-79-6, is a chemical compound characterized by its unique structural features, including a trifluoromethyl group and a sulfonyl ether moiety. This compound exhibits significant polarity due to the presence of fluorine atoms, which can enhance its reactivity and solubility in polar solvents. The presence of the 4-methylphenyl groups contributes to its hydrophobic characteristics, potentially influencing its biological activity and interaction with other molecules. The imine functional group indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the compound's stereochemistry, indicated by the (1Z) configuration, suggests specific spatial arrangements that can affect its reactivity and interactions with biological targets. Overall, this compound's unique combination of functional groups and stereochemistry makes it of interest in fields such as medicinal chemistry and materials science, where its properties can be exploited for various applications.
Formula:C16H14F3NO3S
InChI:InChI=1/C16H14F3NO3S/c1-11-3-7-13(8-4-11)15(16(17,18)19)20-23-24(21,22)14-9-5-12(2)6-10-14/h3-10H,1-2H3/b20-15-
SMILES:Cc1ccc(cc1)/C(=N/OS(=O)(=O)c1ccc(C)cc1)/C(F)(F)F
Synonyms:- 2,2,2-Trifluoro-1-(4-methylphenyl)-O-[(4-methylphenyl)
- 4-Methyl-a,a,a-Trifluoroacetophenone Oxime Tosylate
- 2,2,2-Trifluoro-1-(4-methylphenyl)ethanone O-[(4-Methylphenyl)sulfonyl]oxime
- 4-Methyl-α,a,a-Trifluoroacetophenone Oxime Tosylate
- 2,2,2-Trifluoro-1-(4-methylphenyl)ethanone O-Tosyl Oxime
- 2,2,2-Trifluoro-1-(4-methylphenyl)-O-[(4-methylphenyl)sulfonyl]oxime ethanone
- sulfonyl]oxime ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.