CAS 87736-82-1
:3-(4-methylphenyl)-3-(trifluoromethyl)diaziridine
Description:
3-(4-Methylphenyl)-3-(trifluoromethyl)diaziridine is a diaziridine compound characterized by its unique structure, which includes a diaziridine ring and substituents that significantly influence its chemical properties. The presence of a trifluoromethyl group enhances its reactivity and lipophilicity, making it a compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. The 4-methylphenyl group contributes to its aromatic character, potentially affecting its stability and interaction with other molecules. Diaziridines are known for their strain due to the presence of a three-membered nitrogen-containing ring, which can lead to interesting reactivity patterns, including the potential for ring-opening reactions. This compound may exhibit properties such as moderate volatility and solubility in organic solvents, typical of many organic compounds with similar structures. Its unique combination of functional groups may also impart specific biological activities, making it a candidate for further research in medicinal chemistry. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity.
Formula:C9H9F3N2
InChI:InChI=1/C9H9F3N2/c1-6-2-4-7(5-3-6)8(13-14-8)9(10,11)12/h2-5,13-14H,1H3
SMILES:Cc1ccc(cc1)C1(C(F)(F)F)NN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(4-Methylphenyl)-3-(trifluoromethyl)diaziridine
CAS:Controlled Product<p>Applications 3-(4-Methylphenyl)-3-(trifluoromethyl)diaziridine (cas# 87736-82-1) is a compound useful in organic synthesis.<br></p>Formula:C9H9F3N2Color and Shape:NeatMolecular weight:202.18
