CAS 87736-85-4
:3-(4-methylphenyl)-3-(trifluoromethyl)-3H-diazirene
Description:
3-(4-Methylphenyl)-3-(trifluoromethyl)-3H-diazirene, with the CAS number 87736-85-4, is a diazirene compound characterized by its unique structure, which includes a diazirene ring and substituents that significantly influence its chemical properties. The presence of the trifluoromethyl group enhances its reactivity and stability, while the para-methylphenyl group contributes to its hydrophobic characteristics. This compound is typically used in organic synthesis and photochemistry due to its ability to generate reactive intermediates upon irradiation. Diazirenes are known for their potential to undergo thermal or photochemical decomposition, leading to the formation of nitrogen gas and reactive species, which can be utilized in various chemical transformations. Additionally, the trifluoromethyl group can impart unique electronic properties, making the compound of interest in materials science and medicinal chemistry. Overall, 3-(4-methylphenyl)-3-(trifluoromethyl)-3H-diazirene is a versatile compound with applications in synthetic organic chemistry and the development of new materials.
Formula:C9H7F3N2
InChI:InChI=1/C9H7F3N2/c1-6-2-4-7(5-3-6)8(13-14-8)9(10,11)12/h2-5H,1H3
SMILES:Cc1ccc(cc1)C1(C(F)(F)F)N=N1
Synonyms:- 3-(4-Tolyl)-3-(trifluoromethyl)diazirine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(4-Methylphenyl)-3-(trifluoromethyl)diazirine
CAS:Controlled ProductApplications 3-(4-Methylphenyl)-3-(trifluoromethyl)diazirine is used in photoaffinity probes.
References Platz, M., et al.: Bioconjugate Chem., 2, 337 (1991),Formula:C9H7F3N2Color and Shape:NeatMolecular weight:200.16

