CymitQuimica logo

CAS 87740-05-4

:

4-[(4-Nitrophenoxy)methyl]benzoic acid

Description:
4-[(4-Nitrophenoxy)methyl]benzoic acid, with the CAS number 87740-05-4, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, contributing to its acidic properties. The compound also contains a nitrophenoxy group, which is a phenyl ring substituted with a nitro group (-NO2) and linked through a methylene (-CH2-) bridge. This structure imparts both hydrophilic and lipophilic characteristics, influencing its solubility in various solvents. The presence of the nitro group can enhance the compound's reactivity and potential applications in organic synthesis, pharmaceuticals, or as a dye. Additionally, the compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry. Its stability, melting point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, 4-[(4-Nitrophenoxy)methyl]benzoic acid is a versatile compound with potential applications in various fields of chemistry.
Formula:C14H11NO5
InChI:InChI=1S/C14H11NO5/c16-14(17)11-3-1-10(2-4-11)9-20-13-7-5-12(6-8-13)15(18)19/h1-8H,9H2,(H,16,17)
InChI key:InChIKey=OJGWJMNQVVFIIN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(COC2=CC=C(N(=O)=O)C=C2)C=C1
Synonyms:
  • 4-[(4-Nitrophenoxy)methyl]benzoic acid
  • Benzoic acid, 4-[(4-nitrophenoxy)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.