CymitQuimica logo

CAS 87741-94-4

:

2-Phenyl-6-quinolinol

Description:
2-Phenyl-6-quinolinol, with the CAS number 87741-94-4, is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a hydroxyl group (-OH) at the 6-position and a phenyl group at the 2-position of the quinoline ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydroxyl group allows for potential hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-Phenyl-6-quinolinol may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical compounds. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions, making it essential to refer to specific experimental data for precise applications.
Formula:C15H11NO
InChI:InChI=1S/C15H11NO/c17-13-7-9-15-12(10-13)6-8-14(16-15)11-4-2-1-3-5-11/h1-10,17H
InChI key:InChIKey=ITPZZVLPTWDTNZ-UHFFFAOYSA-N
SMILES:OC1=CC2=C(N=C(C=C2)C3=CC=CC=C3)C=C1
Synonyms:
  • 2-Phenyl-6-hydroxyquinoline
  • 6-Quinolinol, 2-phenyl-
  • 6-Hydroxy-2-phenylquinoline
  • 2-Phenyl-6-quinolinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.