CAS 87746-47-2

Sigmoidin B

Description:

Sigmoidin B, with the CAS number 87746-47-2, is a chemical compound that belongs to the class of natural products known as alkaloids. It is primarily derived from certain plant species and is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Sigmoidin B has been studied for its potential pharmacological properties, including antimicrobial and anti-inflammatory effects. Its mechanism of action often involves interaction with specific biological targets, which can lead to various therapeutic applications. The compound is usually isolated through extraction and purification processes from plant sources, and its characterization involves techniques such as NMR spectroscopy and mass spectrometry to determine its structure and purity. As with many natural products, the study of Sigmoidin B continues to evolve, with ongoing research aimed at understanding its full range of biological activities and potential uses in medicine.

Formula: C₂₀H₂₀O₆

InChI: InChI=1S/C20H20O6/c1-10(2)3-4-11-5-12(6-16(24)20(11)25)17-9-15(23)19-14(22)7-13(21)8-18(19)26-17/h3,5-8,17,21-22,24-25H,4,9H2,1-2H3/t17-/m0/s1

InChI key: InChIKey=SFQIGPZCFNTPOD-KRWDZBQOSA-N

SMILES: O=C1C=2C(O[C@@H](C1)C3=CC(CC=C(C)C)=C(O)C(O)=C3)=CC(O)=CC2O

Synonyms:

• (2S)-2-[3,4-Dihydroxy-5-(3-methyl-2-buten-1-yl)phenyl]-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
• 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxy-5-(3-methyl-2-butenyl)phenyl)-2,3-dihydro-5,7-di- hydroxy-, (S)-
• 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxy-5-(3-methyl-2-butenyl)phenyl)-2,3-dihydro-5,7-dihydroxy-, (S)-
• 4H-1-Benzopyran-4-one, 2-[3,4-dihydroxy-5-(3-methyl-2-butenyl)phenyl]-2,3-dihydro-5,7-dihydroxy-, (2S)-
• 4H-1-benzopyran-4-one, 2-[3,4-dihydroxy-5-(3-methyl-2-buten-1-yl)phenyl]-2,3-dihydro-5,7-dihydroxy-, (2S)-
• Sigmoidin B
• Uralenin

Sigmoidin B

CAS: 87746-47-2

Sigmoidin B is a natural compound that is classified as a terpenoid, which is sourced from certain species of terrestrial and marine plants. Its bioactive properties stem from its ability to interact with cellular components, particularly by inducing apoptosis in cancer cells, thereby exhibiting potent cytotoxic effects. The mode of action involves disruption of cellular pathways that are crucial for cancer cell survival and proliferation.

Formula: C₂₀H₂₀O₆

Purity: Min. 95%

Molecular weight: 356.37 g/mol

Ref: 3D-XS161553