CAS 87751-33-5
:quinoline-3,4-diamine
Description:
Quinoline-3,4-diamine, with the CAS number 87751-33-5, is an organic compound characterized by its structure, which features a quinoline ring substituted with amino groups at the 3 and 4 positions. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. Quinoline derivatives are often studied for their biological activities, including antimicrobial and antitumor properties. The presence of amino groups enhances its reactivity and solubility in polar solvents, making it useful in synthetic chemistry. Additionally, quinoline-3,4-diamine may participate in various chemical reactions, such as electrophilic substitutions and coupling reactions, due to the electron-donating nature of the amino groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, quinoline-3,4-diamine is a compound of interest due to its unique structural features and potential utility in research and industry.
Formula:C9H9N3
InChI:InChI=1/C9H9N3/c10-7-5-12-8-4-2-1-3-6(8)9(7)11/h1-5H,10H2,(H2,11,12)
SMILES:c1ccc2c(c1)c(=N)c(c[nH]2)N
Synonyms:- 3,4-Diaminoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Quinoline-3,4-diamine
CAS:<p>Quinoline-3,4-diamine is a heterocyclic compound with a nitrogen atom in the ring. It is classified as an aromatic compound and has many different substituents. The most common are the methyl group, ethyl group, and enamine. Quinoline-3,4-diamine is used in the synthesis of pyridine compounds such as carbonyl chlorides and hydroxyl amines. It also reacts with alkoxy groups to form esters. Quinoline-3,4-diamine has been shown to have antioxidant properties and may be useful for treating dementia.</p>Formula:C9H9N3Purity:Min. 95%Molecular weight:159.19 g/mol
