
CAS 877603-52-6
:4-Iodo-2-methyl-1-(1-methylethoxy)benzene
Description:
4-Iodo-2-methyl-1-(1-methylethoxy)benzene, with the CAS number 877603-52-6, is an organic compound characterized by the presence of an iodine atom, a methyl group, and an ethoxy substituent on a benzene ring. This compound features a substituted aromatic structure, which typically imparts unique chemical properties such as increased reactivity in electrophilic aromatic substitution reactions. The iodine atom serves as a strong electron-withdrawing group, influencing the compound's reactivity and stability. The presence of the 1-methylethoxy group enhances its solubility in organic solvents and may affect its boiling and melting points. Additionally, the compound's molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of more complex molecules. Its specific physical and chemical properties, such as boiling point, melting point, and solubility, would need to be determined through experimental methods or referenced from reliable chemical databases. Overall, 4-Iodo-2-methyl-1-(1-methylethoxy)benzene is a versatile compound with potential utility in various chemical applications.
Formula:C10H13IO
InChI:InChI=1S/C10H13IO/c1-7(2)12-10-5-4-9(11)6-8(10)3/h4-7H,1-3H3
InChI key:InChIKey=UWQBKNMRXTZRAQ-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(C)C=C(I)C=C1
Synonyms:- 4-Iodo-2-methyl-1-(1-methylethoxy)benzene
- Benzene, 4-iodo-2-methyl-1-(1-methylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.