CAS 87764-46-3

3-Deoxy-3-Fluoro-D-Mannose

Description:

3-Deoxy-3-Fluoro-D-Mannose is a synthetic analog of the naturally occurring sugar D-mannose, characterized by the substitution of a fluorine atom at the 3-position of the mannose molecule. This modification alters its chemical properties and biological activity. The compound is typically a white to off-white solid and is soluble in water, which is a common characteristic of many monosaccharides. Its molecular formula reflects the presence of carbon, hydrogen, oxygen, and fluorine, indicating that it retains the basic structure of a sugar while incorporating the fluorine atom. 3-Deoxy-3-Fluoro-D-Mannose is of interest in biochemical research, particularly in studies related to glycosylation and the development of glycomimetics, which can influence cellular interactions and signaling pathways. The fluorine substitution can enhance the stability and bioavailability of the compound, making it a valuable tool in medicinal chemistry and drug design. As with many fluorinated compounds, it may exhibit unique pharmacokinetic properties, which can be advantageous in therapeutic applications.

Formula: C₆H₁₁FO₅

InChI: InChI=1/C6H11FO5/c7-5(3(10)1-8)6(12)4(11)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6-/m1/s1

SMILES: C(=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)F)O

Synonyms:

• (2R,3S,4R,5R)-3-fluoro-2,4,5,6-tetrahydroxy-hexanal

D-Mannose,3-deoxy-3-fluoro-

CAS: 87764-46-3

Formula: C₆H₁₁FO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 182.1469

Ref: IN-DA004IDD

3-Deoxy-3-fluoro-D-mannose

CAS: 87764-46-3

3-Deoxy-3-fluoro-D-mannose

Purity: ≥95%

Molecular weight: 182.15g/mol

Ref: 54-PC7312

3-Deoxy-3-fluoro-D-mannose

CAS: 87764-46-3

Molecular weight: 182.1

Ref: 7W-GC8304

3-Deoxy-3-fluoro-D-mannose

Controlled Product

CAS: 87764-46-3

Applications Shown to be metabolized in yeast.
References Biochem. J., 209 (3), 677-685 (1983)

Formula: C₆H₁₁FO₅

Color and Shape: Neat

Molecular weight: 182.15

Ref: TR-D235200

3-Deoxy-3-fluoro-D-mannose

CAS: 87764-46-3

3-Deoxy-3-fluoro-D-mannose (3DFM) is a synthetic sugar molecule that acts as an inhibitor of bacterial growth. It binds to the 6-phosphate group of nucleic acids, which prevents the addition of sugar molecules to ribose or deoxyribose groups. 3DFM also inhibits the synthesis of proteins and RNA, which are necessary for bacterial growth. 3DFM is a structural analog of mannose and glucose, and has been shown to be effective against chronic infections caused by bacteria that produce lectins, such as C. difficile. This drug can be used in combination with other antibiotics to enhance their effectiveness.

Formula: C₆H₁₁FO₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 182.15 g/mol

Ref: 3D-MD06720