CAS 87766-35-6

Ethyl octahydropyrrolo[1,2-a]pyrazine-3-carboxylate

Description:

Ethyl octahydropyrrolo[1,2-a]pyrazine-3-carboxylate, with the CAS number 87766-35-6, is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazine ring fused with a pyrrolidine moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in the field of pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. The presence of the ethyl ester functional group contributes to its reactivity, making it amenable to various chemical transformations. Additionally, the compound may exhibit interesting biological activities, although specific data on its pharmacological properties may vary. Its solubility in organic solvents and moderate stability under standard conditions are also notable characteristics. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.

Formula: C₁₀H₁₈N₂O₂

InChI: InChI=1S/C10H18N2O2/c1-2-14-10(13)9-7-12-5-3-4-8(12)6-11-9/h8-9,11H,2-7H2,1H3

InChI key: InChIKey=WRGHWTGGZJAABT-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1CN2C(CN1)CCC2

Synonyms:

• Pyrrolo[1,2-a]pyrazine-3-carboxylic acid, octahydro-, ethyl ester
• Ethyl octahydropyrrolo[1,2-a]pyrazine-3-carboxylate