
CAS 877660-90-7
:2-[(1S,6S)-3-Methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol
Description:
The chemical substance known as 2-[(1S,6S)-3-Methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol, with the CAS number 877660-90-7, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including a cyclohexene ring and a benzenediol moiety, which contribute to its potential biological activity and chemical reactivity. The presence of alkyl chains, such as the pentyl group, suggests hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The stereochemistry indicated by the (1S,6S) configuration implies specific spatial arrangements that can affect the compound's pharmacological properties. This compound may exhibit interesting properties in fields such as medicinal chemistry or materials science, although specific applications and biological activities would require further investigation. Overall, its intricate structure and functional groups make it a subject of interest for further research in various chemical and biological contexts.
Formula:C21H32O2
InChI:InChI=1S/C21H32O2/c1-5-6-7-8-16-12-19(22)21(20(23)13-16)18-11-15(4)9-10-17(18)14(2)3/h11-14,17-18,22-23H,5-10H2,1-4H3/t17-,18+/m0/s1
InChI key:InChIKey=PCXRACLQFPRCBB-ZWKOTPCHSA-N
SMILES:C(C)(C)[C@H]1[C@@H](C=C(C)CC1)C2=C(O)C=C(CCCCC)C=C2O
Synonyms:- 2-[(1S,6S)-3-Methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol
- 8,9-Dihydrocannabidiol
- 1,3-Benzenediol, 2-[(1S,6S)-3-methyl-6-(1-methylethyl)-2-cyclohexen-1-yl]-5-pentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Antiviral agent 46
CAS:Antiviral agent 46, also known as compound 4, is a cannabidiol (CBD) derivative exhibiting anti-SARS-CoV-2 activity (IC50: 1.90 μM) and ACE2 inhibition (IC50: 1.37 μM) [1].Formula:C21H32O2Color and Shape:SolidMolecular weight:316.48
