CAS 877675-72-4
:2,3-Bis(1-methylethyl)-2-cyclopropen-1-one
Description:
2,3-Bis(1-methylethyl)-2-cyclopropen-1-one, identified by its CAS number 877675-72-4, is an organic compound characterized by its unique cyclopropene structure, which features a three-membered carbon ring. This compound contains two isopropyl groups attached to the cyclopropene ring, contributing to its stability and reactivity. The presence of the carbonyl group (C=O) in the structure indicates that it may exhibit electrophilic behavior, making it a potential candidate for various chemical reactions, including nucleophilic additions. Its molecular geometry is influenced by the steric effects of the isopropyl substituents, which can affect its physical properties such as boiling point and solubility. Additionally, the compound may display interesting optical properties due to the conjugation within the ring system. While specific data on its applications may be limited, compounds with similar structures are often explored in fields such as materials science and organic synthesis for their unique reactivity and potential utility in creating novel chemical entities.
Formula:C9H14O
InChI:InChI=1S/C9H14O/c1-5(2)7-8(6(3)4)9(7)10/h5-6H,1-4H3
InChI key:InChIKey=XHIQOSILEKQTPG-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C(C(C)C)C1=O
Synonyms:- 2-Cyclopropen-1-one, 2,3-bis(1-methylethyl)-
- 2,3-Diisopropylcyclopropenone
- 2,3-Bis(1-methylethyl)-2-cyclopropen-1-one
- 2,3-Diisopropylcycloprop-2-en-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Bis(1-methylethyl)-2-cyclopropen-1-one
CAS:Controlled Product<p>Applications 2,3-Bis(1-methylethyl)-2-cyclopropen-1-one is a useful reagent for the cyclodehydration of diols to cyclic ethers.<br>References Kelly, B.D., et al.: Org. Lett., 13, 740-43 (2011);<br></p>Formula:C9H14OColor and Shape:NeatMolecular weight:138.207
