CAS 877675-72-4

2,3-Bis(1-methylethyl)-2-cyclopropen-1-one

Description:

2,3-Bis(1-methylethyl)-2-cyclopropen-1-one, identified by its CAS number 877675-72-4, is an organic compound characterized by its unique cyclopropene structure, which features a three-membered carbon ring. This compound contains two isopropyl groups attached to the cyclopropene ring, contributing to its stability and reactivity. The presence of the carbonyl group (C=O) in the structure indicates that it may exhibit electrophilic behavior, making it a potential candidate for various chemical reactions, including nucleophilic additions. Its molecular geometry is influenced by the steric effects of the isopropyl substituents, which can affect its physical properties such as boiling point and solubility. Additionally, the compound may display interesting optical properties due to the conjugation within the ring system. While specific data on its applications may be limited, compounds with similar structures are often explored in fields such as materials science and organic synthesis for their unique reactivity and potential utility in creating novel chemical entities.

Formula: C₉H₁₄O

InChI: InChI=1S/C9H14O/c1-5(2)7-8(6(3)4)9(7)10/h5-6H,1-4H3

InChI key: InChIKey=XHIQOSILEKQTPG-UHFFFAOYSA-N

SMILES: C(C)(C)C1=C(C(C)C)C1=O

Synonyms:

• 2-Cyclopropen-1-one, 2,3-bis(1-methylethyl)-
• 2,3-Diisopropylcyclopropenone
• 2,3-Bis(1-methylethyl)-2-cyclopropen-1-one
• 2,3-Diisopropylcycloprop-2-en-1-one

2,3-Bis(1-methylethyl)-2-cyclopropen-1-one

Controlled Product

CAS: 877675-72-4

Applications 2,3-Bis(1-methylethyl)-2-cyclopropen-1-one is a useful reagent for the cyclodehydration of diols to cyclic ethers.
References Kelly, B.D., et al.: Org. Lett., 13, 740-43 (2011);

Formula: C₉H₁₄O

Color and Shape: Neat

Molecular weight: 138.207

Ref: TR-B435310