CAS 87769-56-0

4-Pyridazinecarboxamide, 2,3-dihydro-3-oxo-6-phenyl-

Description:

4-Pyridazinecarboxamide, 2,3-dihydro-3-oxo-6-phenyl- (CAS 87769-56-0) is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the phenyl group enhances its lipophilicity and may influence its interaction with biological targets. The dihydro-3-oxo moiety indicates the presence of a ketone functional group, which can participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 4-Pyridazinecarboxamide derivatives are of interest for their potential applications in drug development and other chemical syntheses.

Formula: C₁₁H₉N₃O₂

InChI: InChI=1S/C11H9N3O2/c12-10(15)8-6-9(13-14-11(8)16)7-4-2-1-3-5-7/h1-6H,(H2,12,15)(H,14,16)

InChI key: MNHJGWMXKBMNTD-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=NNC(=O)C(=C2)C(=O)N