CAS 87769-63-9
:5-amino-6-phenylpyridazin-3(2H)-one
Description:
5-Amino-6-phenylpyridazin-3(2H)-one is a heterocyclic organic compound characterized by its pyridazine ring structure, which is a six-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a phenyl group (C6H5) attached to the pyridazine core, contributing to its chemical reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile in various chemical reactions. Its phenyl substituent can influence the compound's lipophilicity and overall stability. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced or altered biological activities. As with many heterocycles, the compound's properties, such as solubility and melting point, can vary significantly based on the presence of substituents and the overall molecular conformation.
Formula:C10H9N3O
InChI:InChI=1/C10H9N3O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H3,11,12,14)
Synonyms:- 5-amino-6-phenyl-2,3-dihydropyridazin-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
