CAS 87779-79-1

1-Bromo-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one

Description:

1-Bromo-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one is a chemical compound characterized by its unique bicyclic structure, which incorporates both a bromine atom and a ketone functional group. This compound features a fused ring system that contributes to its stability and reactivity. The presence of the bromine atom enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ketone group introduces polar characteristics, influencing its solubility and reactivity in organic solvents. Typically, compounds of this nature exhibit moderate to low volatility and may have specific applications in organic synthesis, medicinal chemistry, or as intermediates in the production of more complex molecules. Additionally, the stereochemistry of the compound can play a significant role in its biological activity and interaction with other molecules. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 1-Bromo-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₁H₁₁BrO

InChI: InChI=1S/C11H11BrO/c12-10-6-3-5-9-8(10)4-1-2-7-11(9)13/h3,5-6H,1-2,4,7H2

InChI key: InChIKey=BPAUWFSOUHQYFG-UHFFFAOYSA-N

SMILES: O=C1C=2C(=C(Br)C=CC2)CCCC1

Synonyms:

• 1-Bromo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-one
• 1-Bromo-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one
• 5H-Benzocyclohepten-5-one, 1-bromo-6,7,8,9-tetrahydro-