CAS 87780-27-6

2-(2,6-dimethoxyphenoxy)ethanamine

Description:

2-(2,6-Dimethoxyphenoxy)ethanamine, with the CAS number 87780-27-6, is an organic compound characterized by its structure, which includes an ethanamine group linked to a 2,6-dimethoxyphenoxy moiety. This compound typically exhibits properties associated with both amines and ether functionalities, which can influence its solubility, reactivity, and potential biological activity. The presence of methoxy groups on the aromatic ring can enhance its lipophilicity and may also affect its interaction with biological targets. As an amine, it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The compound's specific applications and behavior in biological systems would depend on its molecular interactions, making it of interest in medicinal chemistry and pharmacology. However, detailed studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential therapeutic effects. Safety data and handling precautions should also be considered when working with this substance in a laboratory setting.

Formula: C₁₀H₁₅NO₃

InChI: InChI=1/C10H15NO3/c1-12-8-4-3-5-9(13-2)10(8)14-7-6-11/h3-5H,6-7,11H2,1-2H3

SMILES: COc1cccc(c1OCCN)OC

2-(2,6-dimethoxyphenoxy)ethanamine

CAS: 87780-27-6

Formula: C₁₀H₁₆ClNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 233.6919

Ref: IN-DA004I8P

2-(2-Aminoethoxy)-1,3-dimethoxybenzene hydrochloride

CAS: 87780-27-6

2-(2-Aminoethoxy)-1,3-dimethoxybenzene hydrochloride

Purity: 97%

Molecular weight: 233.69g/mol

Ref: 54-OR77437

2-(2-Aminoethoxy)-1,3-dimethoxybenzene hydrochloride

CAS: 87780-27-6

Purity: 97%

Molecular weight: 233.6900024

Ref: 10-F663287