CAS 87782-49-8

1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-ethenylpyrimidine-2,4(1H,3H)-dione

Description:

1-(2-Deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-ethenylpyrimidine-2,4(1H,3H)-dione, with the CAS number 87782-49-8, is a synthetic nucleoside analog that exhibits structural similarities to naturally occurring nucleosides. This compound features a pyrimidine ring, which is a key component in nucleic acid structures, and incorporates a 2-deoxy-2-fluoro-beta-D-arabinofuranosyl moiety, enhancing its stability and bioactivity. The presence of the ethenyl group contributes to its potential as an antiviral or anticancer agent by interfering with nucleic acid synthesis. Its fluorine substitution can improve metabolic stability and alter the compound's interaction with biological targets. This substance is typically studied for its pharmacological properties, particularly in the context of antiviral therapies, as it may inhibit viral replication by mimicking natural nucleosides. The compound's solubility, stability, and reactivity are influenced by its unique structural features, making it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₁H₁₃FN₂O₅

InChI: InChI=1/C11H13FN2O5/c1-2-5-3-14(11(18)13-9(5)17)10-7(12)8(16)6(4-15)19-10/h2-3,6-8,10,15-16H,1,4H2,(H,13,17,18)/t6-,7+,8-,10-/m1/s1