CymitQuimica logo

CAS 877825-74-6

:

Carbamic acid, (2-pyridinylmethyl)-, 2,2,2-trifluoroethyl ester

Description:
Carbamic acid, (2-pyridinylmethyl)-, 2,2,2-trifluoroethyl ester, identified by CAS number 877825-74-6, is an organic compound characterized by its ester functional group derived from carbamic acid and a pyridine derivative. This compound features a pyridinylmethyl group, which contributes to its potential biological activity and interaction with various receptors. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its pharmacokinetic properties, making it of interest in medicinal chemistry. Typically, such compounds exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the surrounding environment and functional groups present. The trifluoromethyl moiety is known for imparting unique electronic properties, which can affect the compound's overall polarity and solubility in different solvents. Additionally, the compound may exhibit specific biological activities, making it a candidate for further research in drug development or agrochemical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or environmental impact.
Formula:C9H9F3N2O2
InChI:InChI=1S/C9H9F3N2O2/c10-9(11,12)6-16-8(15)14-5-7-3-1-2-4-13-7/h1-4H,5-6H2,(H,14,15)
InChI key:InChIKey=IFGNOFKLYCCDAZ-UHFFFAOYSA-N
SMILES:C(NC(OCC(F)(F)F)=O)C1=CC=CC=N1
Synonyms:
  • Carbamic acid, (2-pyridinylmethyl)-, 2,2,2-trifluoroethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.