CAS 877825-78-0

1-[(4-Methoxy-1-naphthalenyl)carbonyl]-4-piperidinecarboxylic acid

Description:

1-[(4-Methoxy-1-naphthalenyl)carbonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a naphthalene moiety substituted with a methoxy group and a piperidine ring. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential for forming salts or esters. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The naphthalene ring system provides aromatic stability and may participate in π-π stacking interactions, which can be significant in biological systems or material applications. Additionally, the piperidine ring introduces basicity, allowing for interactions with various biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its specific applications and behavior would depend on further studies and characterization in various environments.

Formula: C₁₈H₁₉NO₄

InChI: InChI=1S/C18H19NO4/c1-23-16-7-6-15(13-4-2-3-5-14(13)16)17(20)19-10-8-12(9-11-19)18(21)22/h2-7,12H,8-11H2,1H3,(H,21,22)

InChI key: InChIKey=NATACBSMEZFBCP-UHFFFAOYSA-N

SMILES: C(=O)(C=1C2=C(C(OC)=CC1)C=CC=C2)N3CCC(C(O)=O)CC3

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[(4-methoxy-1-naphthalenyl)carbonyl]-
• 1-[(4-Methoxy-1-naphthalenyl)carbonyl]-4-piperidinecarboxylic acid

1-(4-Methoxynaphthalene-1-carbonyl)piperidine-4-carboxylic acid

CAS: 877825-78-0

Versatile small molecule scaffold

Formula: C₁₈H₁₉NO₄

Purity: Min. 95%

Molecular weight: 313.3 g/mol

Ref: 3D-CKB82578