CAS 87783-81-1

Acetamide, N-[2-[(acetylamino)methyl]-4-(2-methylpropyl)-5-oxazolyl]-

Description:

Acetamide, N-[2-[(acetylamino)methyl]-4-(2-methylpropyl)-5-oxazolyl]- is a chemical compound characterized by its complex structure, which includes an acetamide functional group and an oxazole ring. This compound typically exhibits properties associated with both amides and heterocyclic compounds. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The oxazole ring contributes to its potential biological activity, as many oxazole derivatives are known for their pharmacological properties. The presence of the acetylamino and isopropyl groups may influence its reactivity and interaction with biological systems. As with many organic compounds, its stability can be affected by environmental factors such as temperature and pH. Safety data should be consulted for handling and potential toxicity, as the specific biological effects and applications of this compound would depend on its precise structure and functional groups.

Formula: C₁₂H₁₉N₃O₃

InChI: InChI=1S/C12H19N3O3/c1-7(2)5-10-12(14-9(4)17)18-11(15-10)6-13-8(3)16/h7H,5-6H2,1-4H3,(H,13,16)(H,14,17)

InChI key: CWJJPSBBUZOLKR-UHFFFAOYSA-N

SMILES: CC(C)CC1=C(OC(=N1)CNC(=O)C)NC(=O)C