CAS 87786-06-9

2-(1-methyl-1H-imidazol-2-yl)ethanamine

Description:

2-(1-methyl-1H-imidazol-2-yl)ethanamine, also known by its CAS number 87786-06-9, is an organic compound characterized by the presence of an imidazole ring and an ethylamine side chain. This substance features a methyl group attached to the imidazole nitrogen, which contributes to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound exhibits basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or metabolic pathways. Additionally, the imidazole moiety is known for its role in biological systems, often found in amino acids and enzymes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₁₁N₃

InChI: InChI=1/C6H11N3/c1-9-5-4-8-6(9)2-3-7/h4-5H,2-3,7H2,1H3

SMILES: Cn1ccnc1CCN

Synonyms:

• 1H-imidazole-2-ethanamine, 1-methyl-
• 2-(1-Methyl-1H-imidazol-2-yl)ethanamine

2-(1-Methyl-1H-imidazol-2-yl)ethanamine

CAS: 87786-06-9

Formula: C₆H₁₁N₃

Molecular weight: 125.1716

Ref: IN-DA008D3P

2-(1-Methyl-1H-imidazol-2-yl)ethanamine dihydrochloride

CAS: 87786-06-9

Formula: C₆H₁₁N₃

Purity: 95.0%

Molecular weight: 125.175

Ref: 10-F311105