CAS 87786-11-6

1H-Imidazole-5-methanamine, 1,2-dimethyl-, hydrochloride (1:2)

Description:

1H-Imidazole-5-methanamine, 1,2-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound is a derivative of imidazole, featuring a methanamine group and two methyl groups attached to the nitrogen atoms of the imidazole ring. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various applications, including pharmaceuticals and biochemistry. The presence of the hydrochloride indicates that it can exist as a stable salt, which often improves the compound's stability and bioavailability. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The compound may exhibit properties such as basicity due to the nitrogen atoms in the imidazole ring, which can participate in protonation and hydrogen bonding. Overall, this compound's unique structure and properties make it a subject of interest in various chemical and biological research fields.

Formula: C₆H₁₁N₃·2ClH

InChI: InChI=1S/C6H11N3.2ClH/c1-5-8-4-6(3-7)9(5)2;;/h4H,3,7H2,1-2H3;2*1H

InChI key: InChIKey=VEYVLALOOKWLFD-UHFFFAOYSA-N

SMILES: C(N)C=1N(C)C(C)=NC1.Cl

Synonyms:

• 1H-Imidazole-5-methanamine, 1,2-dimethyl-, hydrochloride (1:2)
• 1H-Imidazole-5-methanamine, 1,2-dimethyl-, dihydrochloride