CymitQuimica logo

CAS 87787-49-3

:

1-[(4-Fluorophenyl)sulfonyl]-3-methylbenzene

Description:
1-[(4-Fluorophenyl)sulfonyl]-3-methylbenzene, also known by its CAS number 87787-49-3, is an organic compound characterized by the presence of a sulfonyl group attached to a phenyl ring that is further substituted with a fluorine atom. This compound features a methyl group on the aromatic ring, contributing to its overall hydrophobic character. The sulfonyl group (-SO2-) is known for its ability to enhance the solubility and reactivity of organic molecules, making this compound potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. Additionally, the compound's structure suggests it may exhibit specific physical properties such as melting and boiling points, which are influenced by its molecular weight and functional groups. Overall, 1-[(4-Fluorophenyl)sulfonyl]-3-methylbenzene is a compound of interest in synthetic organic chemistry and materials science.
Formula:C13H11FO2S
InChI:InChI=1S/C13H11FO2S/c1-10-3-2-4-13(9-10)17(15,16)12-7-5-11(14)6-8-12/h2-9H,1H3
InChI key:InChIKey=OTJNJSHIASASQC-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC=C(F)C=C1)C2=CC(C)=CC=C2
Synonyms:
  • 1-[(4-Fluorophenyl)Sulfonyl]-3-Methylbenzene
  • Benzene, 1-[(4-fluorophenyl)sulfonyl]-3-methyl-
  • m-((p-Fluorophenyl)sulphonyl)toluene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.