CAS 87787-81-3
:2-[(Dioctadecylamino)carbonyl]benzoic acid
Description:
2-[(Dioctadecylamino)carbonyl]benzoic acid, with the CAS number 87787-81-3, is a chemical compound characterized by its long-chain fatty amine structure, which contributes to its amphiphilic properties. This compound features a benzoic acid moiety, indicating it has both hydrophobic (due to the long dioctadecyl chains) and hydrophilic characteristics (from the carboxylic acid group). It is typically used in applications involving surfactants, emulsifiers, or as a stabilizing agent in various formulations. The presence of the dioctadecyl groups enhances its ability to interact with lipid membranes, making it relevant in fields such as drug delivery and nanotechnology. Additionally, the compound may exhibit unique thermal and solubility properties due to its long hydrocarbon chains, influencing its behavior in different solvents and environments. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C44H79NO3
InChI:InChI=1S/C44H79NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-35-39-45(43(46)41-37-33-34-38-42(41)44(47)48)40-36-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-34,37-38H,3-32,35-36,39-40H2,1-2H3,(H,47,48)
InChI key:InChIKey=QWZDGDRJLIDZKT-UHFFFAOYSA-N
SMILES:C(N(CCCCCCCCCCCCCCCCCC)CCCCCCCCCCCCCCCCCC)(=O)C1=C(C(O)=O)C=CC=C1
Synonyms:- 2-[(Dioctadecylamino)carbonyl]benzoic acid
- Distearyl phthalamic acid
- Distearylphthalamic acid
- Benzoic acid, 2-[(dioctadecylamino)carbonyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.