CAS 877874-01-6

3-amino-1,2,4-benzotriazin-7-ol

Description:

3-Amino-1,2,4-benzotriazin-7-ol is a heterocyclic organic compound characterized by its benzotriazine structure, which includes a triazine ring fused to a benzene ring. This compound features an amino group and a hydroxyl group, contributing to its potential as a versatile building block in organic synthesis and medicinal chemistry. The presence of these functional groups can enhance its reactivity and solubility in various solvents, making it suitable for applications in pharmaceuticals and agrochemicals. The compound may exhibit biological activity, which could be explored for therapeutic purposes. Its molecular structure allows for various substitution reactions, enabling the development of derivatives with tailored properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-amino-1,2,4-benzotriazin-7-ol represents a significant compound in the field of organic chemistry, with potential implications in drug development and material science.

Formula: C₇H₆N₄O

InChI: InChI=1/C7H6N4O/c8-7-9-5-2-1-4(12)3-6(5)10-11-7/h1-3,12H,(H2,8,9,11)

SMILES: c1cc2c(cc1O)nnc(=N)[nH]2

Synonyms:

• 1,2,4-Benzotriazin-7-ol, 3-amino-

3-Aminobenzo[e][1,2,4]triazin-7-ol

CAS: 877874-01-6

Formula: C₇H₆N₄O

Molecular weight: 162.1487

Ref: IN-DA004KY7

3-Aminobenzo[e][1,2,4]triazin-7-ol

CAS: 877874-01-6

3-Aminobenzo[e][1,2,4]triazin-7-ol

Purity: ≥95%

Molecular weight: 162.15g/mol

Ref: 54-OR350397