CymitQuimica logo

CAS 877874-02-7

:

4-[(3-Amino-1,2,4-benzotriazin-7-yl)oxy]-N-methyl-2-pyridinecarboxamide

Description:
4-[(3-Amino-1,2,4-benzotriazin-7-yl)oxy]-N-methyl-2-pyridinecarboxamide, with the CAS number 877874-02-7, is a chemical compound characterized by its complex structure, which includes a benzotriazine moiety linked to a pyridinecarboxamide. This compound features an amino group that enhances its potential for biological activity, particularly in medicinal chemistry. The presence of the pyridine ring contributes to its ability to interact with various biological targets, making it of interest in drug development. The compound is likely to exhibit polar characteristics due to the presence of functional groups such as the carboxamide and amino groups, which can influence its solubility and reactivity. Additionally, the benzotriazine component may impart specific pharmacological properties, including potential anti-cancer or anti-inflammatory effects. As with many synthetic organic compounds, its stability, reactivity, and biological activity would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C14H12N6O2
InChI:InChI=1S/C14H12N6O2/c1-16-13(21)12-7-9(4-5-17-12)22-8-2-3-10-11(6-8)19-20-14(15)18-10/h2-7H,1H3,(H,16,21)(H2,15,18,20)
InChI key:InChIKey=ZNVSAJQPAIEASD-UHFFFAOYSA-N
SMILES:O(C1=CC2=C(C=C1)N=C(N)N=N2)C=3C=C(C(NC)=O)N=CC3
Synonyms:
  • 4-[(3-Amino-1,2,4-benzotriazin-7-yl)oxy]-N-methyl-2-pyridinecarboxamide
  • 4-[(3-Aminobenzo[1,2,4]triazin-7-yl)oxy]pyridine-2-carboxylic acid methylamide
  • 2-Pyridinecarboxamide, 4-[(3-amino-1,2,4-benzotriazin-7-yl)oxy]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.