CAS 87789-61-5

5-(benzyloxy)-2-piperazinopyrimidine

Description:

5-(Benzyloxy)-2-piperazinopyrimidine is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a benzyloxy group and a piperazine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in organic solvents and potential bioactivity due to its ability to interact with biological targets. The presence of the piperazine ring suggests potential pharmacological applications, as piperazine derivatives are often explored for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. The benzyloxy group can enhance lipophilicity, potentially influencing the compound's permeability and absorption characteristics. Additionally, the compound may exhibit specific reactivity patterns typical of pyrimidine derivatives, such as nucleophilic substitution or coordination with metal ions. Overall, 5-(benzyloxy)-2-piperazinopyrimidine represents a versatile scaffold for further chemical modifications and investigations in drug discovery and development.

Formula: C₁₅H₁₈N₄O

InChI: InChI=1S/C15H18N4O/c1-2-4-13(5-3-1)12-20-14-10-17-15(18-11-14)19-8-6-16-7-9-19/h1-5,10-11,16H,6-9,12H2

SMILES: c1ccc(cc1)COc1cnc(nc1)N1CCNCC1

Synonyms:

• 5-(Benzyloxy)-2-(1-piperazinyl)pyrimidine

5-Benzyloxy-2-(1-piperazinyl)pyrimidine

CAS: 87789-61-5

Formula: C₁₅H₁₈N₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 270.3296

Ref: IN-DA00GWEG

5-(Benzyloxy)-2-(Piperazin-1-Yl)Pyrimidine

CAS: 87789-61-5

5-(Benzyloxy)-2-(Piperazin-1-Yl)Pyrimidine

Purity: 95%

Molecular weight: 270.33g/mol

Ref: 54-OR1025265

5-Benzyloxy-2-(1-piperazinyl)pyrimidine

Controlled Product

CAS: 87789-61-5

Applications Intermediate used in the preparation of CNS agents.

Formula: C₁₅H₁₈N₄O

Color and Shape: Neat

Molecular weight: 270.33

Ref: TR-B287750