CAS 87792-15-2
:4-butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl 1,3-benzodioxole-5-carboxylate
Description:
4-butyl-5-oxo-1,2-diphenyl-2,5-dihydro-1H-pyrazol-3-yl 1,3-benzodioxole-5-carboxylate is a complex organic compound characterized by its unique structural features, which include a pyrazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. The presence of the butyl group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The pyrazole ring is known for its diverse pharmacological properties, including anti-inflammatory and analgesic effects. Additionally, the compound's carboxylate group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for comprehensive characterization.
Formula:C27H24N2O5
InChI:InChI=1/C27H24N2O5/c1-2-3-14-22-25(30)28(20-10-6-4-7-11-20)29(21-12-8-5-9-13-21)26(22)34-27(31)19-15-16-23-24(17-19)33-18-32-23/h4-13,15-17H,2-3,14,18H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-BUTYL-1,2-DIHYDRO-5-((3,4-METHYLENEDIOXYBENZOYL)OXY)-1,2-DIPHENYL-3H-PYRAZOL-3-ONE
CAS:Formula:C27H24N2O5Molecular weight:456.4899
