CAS 87794-64-7

9,9-bis[2-(2-methoxyethoxy)ethoxy]-2,5,8-trioxa-9-siladodecan-12-amine

Description:

9,9-bis[2-(2-methoxyethoxy)ethoxy]-2,5,8-trioxa-9-siladodecan-12-amine, with CAS number 87794-64-7, is a siloxane compound characterized by its unique structure that incorporates both siloxane and amine functionalities. This compound features a silicate backbone, which contributes to its stability and potential applications in various fields, including materials science and pharmaceuticals. The presence of multiple ether groups enhances its solubility in organic solvents and may improve its compatibility with other materials. Additionally, the amine group can participate in various chemical reactions, making it a versatile building block in synthetic chemistry. Its molecular structure suggests potential applications in drug delivery systems, surface modification, and as a surfactant due to its amphiphilic nature. The compound's properties, such as thermal stability and reactivity, can be influenced by the length and branching of the ether chains, making it an interesting subject for further research in polymer chemistry and nanotechnology.

Formula: C₁₈H₄₁NO₉Si

InChI: InChI=1/C18H41NO9Si/c1-20-6-9-23-12-15-26-29(18-4-5-19,27-16-13-24-10-7-21-2)28-17-14-25-11-8-22-3/h4-19H2,1-3H3

SMILES: COCCOCCO[Si](CCCN)(OCCOCCOC)OCCOCCOC

Synonyms:

• 3-Aminopropyltris(methoxyethoxyethoxy)silane

3-Aminopropyltris(methoxyethoxyethoxy)silane

CAS: 87794-64-7

Formula: C₁₈H₄₁NO₉Si

Purity: 90%

Color and Shape: Liquid

Molecular weight: 443.6049

Ref: IN-DA004F8G

9,9-Bis(2-(2-methoxyethoxy)ethoxy)-2,5,8-trioxa-9-siladodecan-12-amine

CAS: 87794-64-7

9,9-Bis(2-(2-methoxyethoxy)ethoxy)-2,5,8-trioxa-9-siladodecan-12-amine

Purity: 98%

Ref: 54-OR1039904

3-Aminopropyltris(methoxyethoxyethoxy)silane

CAS: 87794-64-7

Formula: C₁₈H₄₁NO₉Si

Purity: 98%

Color and Shape: Liquid, Clear

Molecular weight: 443.609

Ref: 10-S00830