CAS 87795-44-6

2-Pyridinamine, N-(thienylmethylene)-, 1-oxide

Description:

2-Pyridinamine, N-(thienylmethylene)-, 1-oxide, with the CAS number 87795-44-6, is a chemical compound that features a pyridine ring substituted with an amine group and a thienylmethylene moiety. This compound is characterized by its heterocyclic structure, which includes both nitrogen and sulfur atoms, contributing to its unique chemical properties. The presence of the thienyl group introduces additional reactivity and potential for interactions with various biological targets, making it of interest in medicinal chemistry. The 1-oxide designation indicates that there is an oxygen atom bonded to the nitrogen, which can influence the compound's electron distribution and reactivity. Typically, such compounds may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a candidate for various applications in organic synthesis and pharmaceutical development.

Formula: C₁₀H₈N₂OS

InChI: InChI=1S/C10H8N2OS/c13-12-6-2-1-5-10(12)11-8-9-4-3-7-14-9/h1-8H

InChI key: RJXZSGOPXPNUEN-UHFFFAOYSA-N

SMILES: C1=CC=[N+](C(=C1)N=CC2=CC=CS2)[O-]