CAS 87796-18-7

(9,10-dibromo-2-anthryl)sulfonyloxysodium

Description:

(9,10-dibromo-2-anthryl)sulfonyloxysodium, with the CAS number 87796-18-7, is a chemical compound that features a sulfonate group attached to an anthracene derivative. This compound is characterized by its brominated anthracene structure, which contributes to its unique electronic and optical properties. The presence of the sulfonate group enhances its solubility in polar solvents, making it useful in various applications, including organic electronics and as a potential dye or fluorescent marker. The bromine substituents can influence the compound's reactivity and stability, allowing for potential modifications in synthetic pathways. Additionally, the compound may exhibit interesting photophysical properties, such as fluorescence, which can be exploited in materials science and photonic applications. Overall, (9,10-dibromo-2-anthryl)sulfonyloxysodium is notable for its structural complexity and potential utility in advanced chemical applications.

Formula: C₁₄H₇Br₂NaO₃S

InChI: InChI=1/C14H8Br2O3S.Na/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(20(17,18)19)5-6-11(12)13;/h1-7H,(H,17,18,19);/q;+1/p-1/rC14H7Br2NaO3S/c15-13-9-3-1-2-4-10(9)14(16)12-7-8(5-6-11(12)13)21(18,19)20-17/h1-7H

SMILES: c1ccc2c(c1)c(c1ccc(cc1c2Br)S(=O)(=O)O)Br.[Na]

9,10-Dibromoanthracene-2-sulfonic Acid Sodium Salt

Controlled Product

CAS: 87796-18-7

Applications 9,10-Dibromoanthracene-2-sulfonic Acid Sodium Salt (cas# 87796-18-7) is a compound useful in organic synthesis.

Formula: C₁₄H₇Br₂O₃S·Na

Color and Shape: Neat

Molecular weight: 438.07

Ref: TR-D423000