CAS 877963-95-6

2-Chloro-N-(2,5-dioxo-4,4-diphenyl-1-imidazolidinyl)acetamide

Description:

2-Chloro-N-(2,5-dioxo-4,4-diphenyl-1-imidazolidinyl)acetamide, identified by its CAS number 877963-95-6, is a synthetic organic compound characterized by its imidazolidine structure, which features a chloro substituent and a diketone moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents and may show limited solubility in non-polar solvents due to its polar functional groups. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The diketone functionality can participate in various chemical transformations, including condensation and oxidation reactions. Additionally, the diphenyl groups contribute to the compound's stability and may influence its electronic properties. This compound may be of interest in medicinal chemistry and material science due to its unique structural features, which could impart specific biological activities or physical properties. As with many synthetic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of this substance would need to be evaluated in detail.

Formula: C₁₇H₁₄ClN₃O₃

InChI: InChI=1S/C17H14ClN3O3/c18-11-14(22)20-21-15(23)17(19-16(21)24,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H,19,24)(H,20,22)

InChI key: InChIKey=JDORNXWMZOGJAF-UHFFFAOYSA-N

SMILES: O=C1C(NC(=O)N1NC(CCl)=O)(C2=CC=CC=C2)C3=CC=CC=C3

Synonyms:

• 2-Chloro-N-(2,5-dioxo-4,4-diphenyl-1-imidazolidinyl)acetamide
• Acetamide, 2-chloro-N-(2,5-dioxo-4,4-diphenyl-1-imidazolidinyl)-