CymitQuimica logo

CAS 877994-07-5

:

5-Methoxypyrazolo[1,5-a]pyridine-3-carboxaldehyde

Description:
5-Methoxypyrazolo[1,5-a]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. It features a methoxy group (-OCH3) and an aldehyde functional group (-CHO) attached to the pyrazole ring, which contributes to its reactivity and potential applications in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its unique structure allows for interactions with biological targets, making it of interest in drug discovery and development. The presence of the aldehyde group suggests potential for further chemical modifications, such as condensation reactions or reductions. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 5-Methoxypyrazolo[1,5-a]pyridine-3-carboxaldehyde is a valuable compound in the field of organic synthesis and pharmaceutical research.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-13-8-2-3-11-9(4-8)7(6-12)5-10-11/h2-6H,1H3
InChI key:InChIKey=CIIVXMYOAIIEQV-UHFFFAOYSA-N
SMILES:C(=O)C1=C2N(N=C1)C=CC(OC)=C2
Synonyms:
  • Pyrazolo[1,5-a]pyridine-3-carboxaldehyde, 5-methoxy-
  • 5-Methoxypyrazolo[1,5-a]pyridine-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.