CAS 878011-67-7

(S)-3-Amino-4-(4-methoxyphenyl)butanoic acid

Description:

(S)-3-Amino-4-(4-methoxyphenyl)butanoic acid, with the CAS number 878011-67-7, is a chiral amino acid derivative characterized by its specific stereochemistry at the 3-position. This compound features an amino group, a carboxylic acid group, and a phenyl ring substituted with a methoxy group, contributing to its unique properties. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. As an amino acid derivative, it is likely to participate in various biochemical processes, potentially acting as a neurotransmitter or modulator. The compound's chirality suggests that it may exhibit different biological activities compared to its enantiomer, making it of interest in pharmaceutical research. Its solubility in polar solvents, stability under physiological conditions, and ability to form hydrogen bonds are important characteristics that may affect its interactions in biological systems. Overall, (S)-3-Amino-4-(4-methoxyphenyl)butanoic acid represents a significant compound for further exploration in medicinal chemistry and drug development.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1/C11H15NO3/c1-15-10-4-2-8(3-5-10)6-9(12)7-11(13)14/h2-5,9H,6-7,12H2,1H3,(H,13,14)/t9-/m0/s1

SMILES: COc1ccc(cc1)C[C@@H](CC(=O)O)N

Benzenebutanoic acid, b-amino-4-methoxy-, (bS)-

CAS: 878011-67-7

Formula: C₁₁H₁₅NO₃

Purity: 97%

Molecular weight: 209.2417

Ref: IN-DA008D33