CAS 87802-08-2
:1,5-Dimethyl-1H-benzimidazole-2-carboxylic acid hydrazide
Description:
1,5-Dimethyl-1H-benzimidazole-2-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a benzimidazole ring substituted with two methyl groups and a hydrazide functional group. This compound typically exhibits properties associated with both benzimidazole derivatives and hydrazides, such as potential biological activity and the ability to form hydrogen bonds due to the presence of the carboxylic acid and hydrazide moieties. It may be soluble in polar solvents, reflecting the influence of its functional groups. The compound is of interest in medicinal chemistry, as benzimidazole derivatives are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. Additionally, the presence of the hydrazide group can enhance its reactivity and potential applications in various chemical reactions. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may vary.
Formula:C10H12N4O
InChI:InChI=1S/C10H12N4O/c1-6-3-4-8-7(5-6)12-9(14(8)2)10(15)13-11/h3-5H,11H2,1-2H3,(H,13,15)
InChI key:InChIKey=VGDSVPHRCVONCM-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1C(NN)=O)=CC(C)=CC2
Synonyms:- 1,5-Dimethyl-1H-1,3-benzodiazole-2-carbohydrazide
- 1,5-Dimethyl-1H-benzimidazole-2-carboxylic acid hydrazide
- 1,5-Dimethylbenzimidazole-2-carbohydrazide
- 1H-Benzimidazole-2-carboxylic acid, 1,5-dimethyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Benzimidazole-2-carboxylic acid, 1,5-dimethyl-, hydrazide
CAS:Formula:C10H12N4OMolecular weight:204.2285
