CymitQuimica logo

CAS 878046-64-1

:

2,3-Dihydro-2-methyl-N-[(tetrahydro-2-furanyl)methyl]-5-benzofuranmethanamine

Description:
2,3-Dihydro-2-methyl-N-[(tetrahydro-2-furanyl)methyl]-5-benzofuranmethanamine, identified by its CAS number 878046-64-1, is a chemical compound that features a complex structure incorporating a benzofuran moiety and a tetrahydrofuran ring. This compound is characterized by its amine functional group, which contributes to its potential as a pharmacological agent. The presence of the benzofuran structure suggests possible biological activity, as many compounds with similar frameworks exhibit various pharmacological properties. The tetrahydrofuran component may enhance solubility and stability, making it suitable for various applications in medicinal chemistry. Additionally, the presence of multiple stereocenters in its structure indicates that it may exist in different stereoisomeric forms, which can significantly influence its biological activity and interactions. Overall, this compound's unique structural features position it as a subject of interest for further research in drug development and synthesis.
Formula:C15H21NO2
InChI:InChI=1S/C15H21NO2/c1-11-7-13-8-12(4-5-15(13)18-11)9-16-10-14-3-2-6-17-14/h4-5,8,11,14,16H,2-3,6-7,9-10H2,1H3
InChI key:InChIKey=BVJLJADGPBUSCS-UHFFFAOYSA-N
SMILES:CC1OC=2C(=CC(CNCC3CCCO3)=CC2)C1
Synonyms:
  • 2,3-Dihydro-2-methyl-N-[(tetrahydro-2-furanyl)methyl]-5-benzofuranmethanamine
  • 5-Benzofuranmethanamine, 2,3-dihydro-2-methyl-N-[(tetrahydro-2-furanyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.