CAS 87808-48-8
:methyl 3-fluoro-4-methyl-benzoate
Description:
Methyl 3-fluoro-4-methylbenzoate, with the CAS number 87808-48-8, is an aromatic ester characterized by its functional groups and molecular structure. It features a benzoate moiety, where a methyl group and a fluorine atom are substituted on the benzene ring at the 3 and 4 positions, respectively. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its pleasant, fruity odor, which is common among many esters. Methyl 3-fluoro-4-methylbenzoate is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the fluorine atom can influence its reactivity and polarity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H9FO2
InChI:InChI=1/C9H9FO2/c1-6-3-4-7(5-8(6)10)9(11)12-2/h3-5H,1-2H3
SMILES:Cc1ccc(cc1F)C(=O)OC
Synonyms:- Benzoic Acid, 3-Fluoro-4-Methyl-, Methyl Ester
- Methyl-3-fluor-4-methylbenzolcarboxylat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-fluoro-4-methylbenzoate
CAS:Formula:C9H9FO2Purity:97%Color and Shape:LiquidMolecular weight:168.1650Methyl 3-fluoro-4-methylbenzoate
CAS:Methyl 3-fluoro-4-methylbenzoatePurity:97%Molecular weight:168.16g/mol3-Fluoro-4-methylbenzoic acid methyl ester
CAS:3-Fluoro-4-methylbenzoic acid methyl ester is a benzoate that can be converted to 3-fluoro-4-methylbenzoic acid (3FMB) by decarboxylation. 3FMB can be used in the synthesis of phenylacetic acid and other aromatic compounds. It also has been shown to function as a radical scavenger, which may have applications in medical research and treatment of neurodegenerative diseases. 3FMB has been shown to inhibit the growth of bacteria when it is applied topically or orally, due to its ability to inhibit DNA synthesis.Formula:C9H9FO2Purity:Min. 95%Molecular weight:168.16 g/molMethyl 3-fluoro-4-methylbenzoate
CAS:Formula:C9H9FO2Purity:95%Color and Shape:Liquid, ClearMolecular weight:168.167



