CAS 87810-56-8
:(+)-Fostriecin
Description:
(+)-Fostriecin is a naturally occurring compound classified as a phosphonate ester, primarily known for its potent biological activity. It is derived from the fermentation of certain fungi, particularly from the genus *Fusarium*. The compound exhibits significant antitumor properties, making it a subject of interest in cancer research. Its mechanism of action involves the inhibition of protein phosphatases, which are crucial for various cellular processes, including cell division and signal transduction. This inhibition can lead to cell cycle arrest and apoptosis in cancer cells. In addition to its antitumor effects, (+)-Fostriecin has also shown potential as an antiviral agent. The compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Due to its potent effects and unique mechanism, (+)-Fostriecin has been studied for its therapeutic potential, although its clinical use is limited by factors such as stability and bioavailability. Overall, it represents a valuable compound in the field of medicinal chemistry and pharmacology.
Formula:C19H27O9P
InChI:InChI=1S/C19H27O9P/c1-19(23,12-11-16-9-7-10-18(22)27-16)17(28-29(24,25)26)14-15(21)8-5-3-2-4-6-13-20/h2-8,10-12,15-17,20-21,23H,9,13-14H2,1H3,(H2,24,25,26)/b3-2-,6-4+,8-5-,12-11+/t15-,16+,17+,19+/m0/s1
InChI key:InChIKey=ZMQRJWIYMXZORG-DSWNLJKISA-N
SMILES:[C@H]([C@](/C=C/[C@@H]1OC(=O)C=CC1)(C)O)(C[C@H](/C=C\C=C/C=C/CO)O)OP(=O)(O)O
Synonyms:- 2H-Pyran-2-one, 5,6-dihydro-6-[(1E,3R,4R,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyl-4-(phosphonooxy)-1,7,9,11-tridecatetraenyl]-, (6R)-
- (6R)-5,6-Dihydro-6-[(1E,3R,4R,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyl-4-(phosphonooxy)-1,7,9,11-tridecatetraen-1-yl]-2H-pyran-2-one
- Antibiotic CL 1565A
- 2H-Pyran-2-one, 5,6-dihydro-6-[3,6,13-trihydroxy-3-methyl-4-(phosphonooxy)-1,7,9,11-tridecatetraenyl]-
- 2H-Pyran-2-one, 5,6-dihydro-6-[(1E,3R,4R,6R,7Z,9Z,11E)-3,6,13-trihydroxy-3-methyl-4-(phosphonooxy)-1,7,9,11-tridecatetraen-1-yl]-, (6R)-
- Fostriecin [INN]
- (1R,3R,4Z,6Z,8E)-3,10-dihydroxy-1-{(1R,2E)-1-hydroxy-1-methyl-3-[(2S)-6-oxo-3,6-dihydro-2H-pyran-2-yl]prop-2-en-1-yl}deca-4,6,8-trien-1-yl dihydrogen phosphate
- CI 920
- UNII-ZO1648L551
- Fostriecina [Spanish]
- Fostriecinum
- Fostriecinum [Latin]
- Antibiotic CI 920
- Phosphotrienin
- Pyranone phosphate
- Fostriecine
- CL 1565A
- PD 110,161
- Fostriecina
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Fostriecin
CAS:Fostriecin is a potent anticancer agent, which is a natural product isolated from the bacterium Streptomyces pulveraceus. It acts primarily as an inhibitor of protein phosphatases, particularly protein phosphatase 2A (PP2A) and protein phosphatase 4 (PP4), functioning by blocking their catalytic activity. This inhibition disrupts cell cycle regulation, leading to apoptosis in cancer cells.Formula:C19H27O9PPurity:Min. 95%Molecular weight:403.4 g/molFostriecin (free base)
CAS:Fostriecin inhibits PP2A/PP4 (IC50s = 3.2/3 nM), weakly affects topoisomerase II/PP1 (IC50s = 40/131 μM), doesn't inhibit PP2B, and may modify epigenetics.Formula:C19H27O9PColor and Shape:SolidMolecular weight:430.39

