CAS 878141-96-9
:4-[2-[[5-Methyl-1-(2-naphthalenyl)-1H-pyrazol-3-yl]oxy]ethyl]morpholine
Description:
4-[2-[[5-Methyl-1-(2-naphthalenyl)-1H-pyrazol-3-yl]oxy]ethyl]morpholine, with the CAS number 878141-96-9, is a synthetic organic compound characterized by its complex structure, which includes a morpholine ring, a pyrazole moiety, and a naphthalene substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the morpholine ring suggests it may interact with biological targets, potentially influencing pharmacological activity. The naphthalene group can contribute to hydrophobic interactions, while the pyrazole unit may participate in hydrogen bonding and other molecular interactions. Overall, this compound's unique structural features may confer specific chemical reactivity and biological properties, warranting further investigation for applications in pharmaceuticals or agrochemicals. As with any chemical substance, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C20H23N3O2
InChI:InChI=1S/C20H23N3O2/c1-16-14-20(25-13-10-22-8-11-24-12-9-22)21-23(16)19-7-6-17-4-2-3-5-18(17)15-19/h2-7,14-15H,8-13H2,1H3
InChI key:InChIKey=DGPGXHRHNRYVDH-UHFFFAOYSA-N
SMILES:CC=1N(C2=CC3=C(C=C2)C=CC=C3)N=C(OCCN4CCOCC4)C1
Synonyms:- E 52862
- MR-309
- 4-[2-[[5-Methyl-1-(2-naphthalenyl)-1H-pyrazol-3-yl]oxy]ethyl]morpholine
- S1RA
- Morpholine, 4-[2-[[5-methyl-1-(2-naphthalenyl)-1H-pyrazol-3-yl]oxy]ethyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
S1RA
CAS:S1RA (E-52862)(E-52862) is a potent, selective antagonist of the sigma-1 receptor (σ1R, Ki=17 nM), demonstrating significant selectivity over the sigma-2Formula:C20H23N3O2Purity:99.45%Color and Shape:SolidMolecular weight:337.42E 52862 (S1RA)
CAS:E 52862 (S1RA) is a monoclonal antibody that targets the α2δ subunit of voltage-gated calcium channels. It blocks the binding of ATP and reduces neuronal excitability, providing antinociception without causing dependence or addiction. E 52862 has been shown to be an effective treatment for diabetic neuropathy in vivo models. The drug has also been shown to have a sub-effective dose, which may reduce its side effects. E 52862's receptor activity may be due to its ability to inhibit glutamate release and cyclin D2 expression, which are both involved in pain transmission.Formula:C20H23N3O2Purity:Min. 95%Molecular weight:337.42 g/mol



