CAS 87815-78-9

N-cyclohexyl-2-nitro-4-(trifluoromethyl)aniline

Description:

N-cyclohexyl-2-nitro-4-(trifluoromethyl)aniline is an organic compound characterized by its complex structure, which includes a cyclohexyl group, a nitro group, and a trifluoromethyl group attached to an aniline backbone. This compound typically appears as a solid at room temperature and is known for its potential applications in various chemical syntheses and as an intermediate in the production of agrochemicals or pharmaceuticals. The presence of the nitro group contributes to its reactivity, while the trifluoromethyl group enhances its lipophilicity and can influence its biological activity. The cyclohexyl substituent may provide steric hindrance, affecting the compound's interaction with other molecules. Additionally, the compound's properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as compounds with nitro and trifluoromethyl groups can pose specific health and environmental risks.

Formula: C₁₃H₁₅F₃N₂O₂

InChI: InChI=1/C13H15F3N2O2/c14-13(15,16)9-6-7-11(12(8-9)18(19)20)17-10-4-2-1-3-5-10/h6-8,10,17H,1-5H2

SMILES: C1CCC(CC1)Nc1ccc(cc1N(=O)=O)C(F)(F)F

Synonyms:

• Cyclohexyl-(2-nitro-4-trifluoromethyl-phenyl)-amine
• Benzenamine, N-cyclohexyl-2-nitro-4-(trifluoromethyl)-
• N-cyclohexyl-2-nitro-4-(trifluoromethyl)aniline