CymitQuimica logo

CAS 878155-06-7

:

3-(4-Morpholinyl)cyclobutanamine

Description:
3-(4-Morpholinyl)cyclobutanamine is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a morpholine moiety. The presence of the morpholine group, a six-membered ring containing both oxygen and nitrogen atoms, contributes to its potential biological activity and solubility properties. This compound typically exhibits properties such as being a solid at room temperature, with moderate polarity due to the morpholine nitrogen and oxygen atoms. It may engage in hydrogen bonding, influencing its interactions with other molecules. The cyclobutane ring adds strain to the structure, which can affect its reactivity and stability. 3-(4-Morpholinyl)cyclobutanamine is of interest in medicinal chemistry, particularly for its potential applications in drug development, as compounds with similar structures have been explored for various therapeutic effects. As with many amines, it may exhibit basicity, allowing it to participate in acid-base reactions. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H16N2O
InChI:InChI=1S/C8H16N2O/c9-7-5-8(6-7)10-1-3-11-4-2-10/h7-8H,1-6,9H2
InChI key:InChIKey=PZRIVFTUPHKMSW-UHFFFAOYSA-N
SMILES:NC1CC(C1)N2CCOCC2
Synonyms:
  • 3-(4-Morpholinyl)cyclobutanamine
  • 3-Morpholinocyclobutanamine
  • Cyclobutanamine, 3-(4-morpholinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.