CymitQuimica logo

CAS 878155-87-4

:

4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-methoxybenzenamine

Description:
4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-methoxybenzenamine, with the CAS number 878155-87-4, is a chemical compound characterized by its unique structure that includes a methoxy group and a hexahydro-1H-1,4-diazepine moiety. This compound typically exhibits properties associated with both aromatic amines and cyclic amines, which may influence its solubility, reactivity, and potential biological activity. The presence of the methoxy group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the hexahydro-1H-1,4-diazepine ring contributes to its structural rigidity and may play a role in interactions with biological targets. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical determination or literature reference for precise values. Overall, this compound's unique structural features suggest it may possess interesting chemical and biological properties worthy of further exploration.
Formula:C12H19N3O
InChI:InChI=1S/C12H19N3O/c1-16-12-9-10(3-4-11(12)13)15-7-2-5-14-6-8-15/h3-4,9,14H,2,5-8,13H2,1H3
InChI key:InChIKey=XPKZGOJEPLBDDF-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1N)N2CCCNCC2
Synonyms:
  • 4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-methoxybenzenamine
  • Benzenamine, 4-(hexahydro-1H-1,4-diazepin-1-yl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.