CymitQuimica logo

CAS 878160-70-4

:

2-Butanol, 4,4-diethoxy-1,1,1-trifluoro-

Description:
2-Butanol, 4,4-diethoxy-1,1,1-trifluoro- is a fluorinated organic compound characterized by its unique structure, which includes a butanol backbone with two ethoxy groups and trifluoromethyl substituents. This compound typically exhibits properties associated with both alcohols and fluorinated compounds, such as moderate polarity and potential solubility in organic solvents. The presence of the trifluoromethyl group can enhance its chemical stability and influence its reactivity, making it useful in various applications, including as a solvent or intermediate in organic synthesis. Additionally, the ethoxy groups may impart certain characteristics like increased hydrophobicity compared to simple alcohols. The compound's specific physical properties, such as boiling point, melting point, and density, would depend on its molecular interactions and the presence of functional groups. As with many fluorinated compounds, it is essential to handle this substance with care due to potential environmental and health impacts associated with fluorinated chemicals.
Formula:C8H15F3O3
InChI:InChI=1S/C8H15F3O3/c1-3-13-7(14-4-2)5-6(12)8(9,10)11/h6-7,12H,3-5H2,1-2H3
InChI key:InChIKey=HGTGRZCCRYZNRP-UHFFFAOYSA-N
SMILES:C(CC(C(F)(F)F)O)(OCC)OCC
Synonyms:
  • 4,4-Diethoxy-1,1,1-trifluoro-2-butanol
  • 2-Butanol, 4,4-diethoxy-1,1,1-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.