CymitQuimica logo

CAS 878167-54-5

:

tert-butyl 5-methylspiro[indoline-3,4'-piperidine]-1-carboxylate hydrochloride

Description:
Tert-butyl 5-methylspiro[indoline-3,4'-piperidine]-1-carboxylate hydrochloride is a chemical compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential solubility in organic solvents. The presence of the indoline and piperidine moieties suggests that it may exhibit interesting biological activities, possibly related to its interaction with various receptors or enzymes. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, which is advantageous for pharmaceutical applications. The compound's CAS number, 878167-54-5, allows for precise identification in chemical databases. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound may have potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C18H27ClN2O2
InChI:InChI=1/C18H26N2O2.ClH/c1-13-5-6-15-14(11-13)18(7-9-19-10-8-18)12-20(15)16(21)22-17(2,3)4;/h5-6,11,19H,7-10,12H2,1-4H3;1H
InChI key:ZVIZHEMABFBZMC-UHFFFAOYSA-N
SMILES:Cc1ccc2c(c1)C1(CCNCC1)CN2C(=O)OC(C)(C)C.Cl
Found 2 products.