CAS 878167-55-6

tert-butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate

Description:

Tert-butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indoline and piperidine moieties. The presence of a tert-butyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. The bromine atom introduces a halogen functionality, which can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. This compound is likely to exhibit interesting pharmacological properties due to its structural features, making it a candidate for research in medicinal chemistry. Its carboxylate functional group may also play a role in interactions with biological targets. The compound's synthesis and reactivity can be influenced by the steric and electronic effects of the substituents on the spiro framework. Overall, tert-butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate represents a valuable structure for further exploration in drug development and organic synthesis.

Formula: C₁₇H₂₃BrN₂O₂

InChI: InChI=1/C17H23BrN2O2/c1-16(2,3)22-15(21)20-8-6-17(7-9-20)11-19-14-5-4-12(18)10-13(14)17/h4-5,10,19H,6-9,11H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC2(CC1)CNc1ccc(cc21)Br

tert-Butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate

CAS: 878167-55-6

Formula: C₁₇H₂₃BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 367.2807

Ref: IN-DA004EOQ

Tert-Butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate

CAS: 878167-55-6

Purity: 95.0%

Molecular weight: 367.2869873046875

Ref: 10-F235098

tert-Butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate

CAS: 878167-55-6

tert-Butyl 5-bromospiro[indoline-3,4'-piperidine]-1'-carboxylate

Purity: ≥95%

Molecular weight: 367.28g/mol

Ref: 54-OR315460