CAS 878194-95-7

[3,3′-Bipyridine]-4-carbonitrile

Description:

[3,3′-Bipyridine]-4-carbonitrile, with the CAS number 878194-95-7, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 3-position, along with a cyano group (-C≡N) attached to one of the rings. This compound typically exhibits properties associated with both aromaticity and basicity due to the presence of nitrogen atoms in the pyridine rings. It is likely to be a solid at room temperature and may be soluble in polar organic solvents. The cyano group contributes to its reactivity, making it useful in various chemical syntheses and applications, including coordination chemistry and as a ligand in metal complexes. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the bipyridine and cyano functionalities. Its potential applications span fields such as materials science, organic synthesis, and medicinal chemistry, where it may serve as a building block for more complex molecules.

Formula: C₁₁H₇N₃

InChI: InChI=1S/C11H7N3/c12-6-9-3-5-14-8-11(9)10-2-1-4-13-7-10/h1-5,7-8H

InChI key: InChIKey=WWJZBYIGMUBSPG-UHFFFAOYSA-N

SMILES: C(#N)C=1C(=CN=CC1)C=2C=CC=NC2

Synonyms:

• [3,3′-Bipyridine]-4-carbonitrile
• [3,3-Bipyridine]-4-carbonitrile

[3,3'-Bipyridine]-4-carbonitrile

CAS: 878194-95-7

Formula: C₁₁H₇N₃

Molecular weight: 181.1934

Ref: IN-DA004EOP